C15H17NO5 — CID 103952990
4-[(3,5-dimethoxyanilino)methyl]benzene-1,2,3-triol (PubChem CID 103952990) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is 4-[(3,5-dimethoxyanilino)methyl]benzene-1,2,3-triol.
| Compound Name | 4-[(3,5-dimethoxyanilino)methyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 103952990 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 4-[(3,5-dimethoxyanilino)methyl]benzene-1,2,3-triol |
| SMILES | COc1cc(NCc2ccc(O)c(O)c2O)cc(OC)c1 |
| InChI | InChI=1S/C15H17NO5/c1-20-11-5-10(6-12(7-11)21-2)16-8-9-3-4-13(17)15(19)14(9)18/h3-7,16-19H,8H2,1-2H3 |
| InChIKey | FVKWBNCFZGZURX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|