C14H17NO4 — CID 64578003
[5-[(3,5-dimethoxyanilino)methyl]furan-2-yl]methanol (PubChem CID 64578003) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is [5-[(3,5-dimethoxyanilino)methyl]furan-2-yl]methanol.
| Compound Name | [5-[(3,5-dimethoxyanilino)methyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 64578003 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | [5-[(3,5-dimethoxyanilino)methyl]furan-2-yl]methanol |
| SMILES | COc1cc(NCc2ccc(CO)o2)cc(OC)c1 |
| InChI | InChI=1S/C14H17NO4/c1-17-13-5-10(6-14(7-13)18-2)15-8-11-3-4-12(9-16)19-11/h3-7,15-16H,8-9H2,1-2H3 |
| InChIKey | NSZWMLYBWHTCKZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 63.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |