C15H19NO4 — CID 64580358
[5-[(4,5-dimethoxy-2-methylanilino)methyl]furan-2-yl]methanol (PubChem CID 64580358) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is [5-[(4,5-dimethoxy-2-methylanilino)methyl]furan-2-yl]methanol.
| Compound Name | [5-[(4,5-dimethoxy-2-methylanilino)methyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 64580358 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | [5-[(4,5-dimethoxy-2-methylanilino)methyl]furan-2-yl]methanol |
| SMILES | COc1cc(C)c(NCc2ccc(CO)o2)cc1OC |
| InChI | InChI=1S/C15H19NO4/c1-10-6-14(18-2)15(19-3)7-13(10)16-8-11-4-5-12(9-17)20-11/h4-7,16-17H,8-9H2,1-3H3 |
| InChIKey | LHEGUYHPSYTPLT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|