C14H12BrF2NO — CID 82857286
3-bromo-N-[(2,4-difluorophenyl)methyl]-5-methoxyaniline (PubChem CID 82857286) has the molecular formula C14H12BrF2NO and a molecular weight of 328.16 g/mol. Its IUPAC name is 3-bromo-N-[(2,4-difluorophenyl)methyl]-5-methoxyaniline.
| Compound Name | 3-bromo-N-[(2,4-difluorophenyl)methyl]-5-methoxyaniline |
|---|---|
| PubChem CID | 82857286 |
| Molecular Formula | C14H12BrF2NO |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 3-bromo-N-[(2,4-difluorophenyl)methyl]-5-methoxyaniline |
| SMILES | COc1cc(Br)cc(NCc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C14H12BrF2NO/c1-19-13-5-10(15)4-12(7-13)18-8-9-2-3-11(16)6-14(9)17/h2-7,18H,8H2,1H3 |
| InChIKey | BELUHYJEASDZRB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |