C14H16N2O4S — CID 61319103
3-[[(2,3-dihydroxyphenyl)methylamino]methyl]benzenesulfonamide (PubChem CID 61319103) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is 3-[[(2,3-dihydroxyphenyl)methylamino]methyl]benzenesulfonamide.
| Compound Name | 3-[[(2,3-dihydroxyphenyl)methylamino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 61319103 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 3-[[(2,3-dihydroxyphenyl)methylamino]methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(CNCc2cccc(O)c2O)c1 |
| InChI | InChI=1S/C14H16N2O4S/c15-21(19,20)12-5-1-3-10(7-12)8-16-9-11-4-2-6-13(17)14(11)18/h1-7,16-18H,8-9H2,(H2,15,19,20) |
| InChIKey | IMZIBNONFJZXKN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|