C10H12N4O2S — CID 43662319
3-(1H-pyrazol-5-ylmethylamino)benzenesulfonamide (PubChem CID 43662319) has the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. Its IUPAC name is 3-(1H-pyrazol-5-ylmethylamino)benzenesulfonamide.
| Compound Name | 3-(1H-pyrazol-5-ylmethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 43662319 |
| Molecular Formula | C10H12N4O2S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 3-(1H-pyrazol-5-ylmethylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(NCc2ccn[nH]2)c1 |
| InChI | InChI=1S/C10H12N4O2S/c11-17(15,16)10-3-1-2-8(6-10)12-7-9-4-5-13-14-9/h1-6,12H,7H2,(H,13,14)(H2,11,15,16) |
| InChIKey | OADMTKGLPPRSOQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |