C13H17N3 — CID 43662434
3-propan-2-yl-N-(1H-pyrazol-5-ylmethyl)aniline (PubChem CID 43662434) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 3-propan-2-yl-N-(1H-pyrazol-5-ylmethyl)aniline.
| Compound Name | 3-propan-2-yl-N-(1H-pyrazol-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 43662434 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 3-propan-2-yl-N-(1H-pyrazol-5-ylmethyl)aniline |
| SMILES | CC(C)c1cccc(NCc2ccn[nH]2)c1 |
| InChI | InChI=1S/C13H17N3/c1-10(2)11-4-3-5-12(8-11)14-9-13-6-7-15-16-13/h3-8,10,14H,9H2,1-2H3,(H,15,16) |
| InChIKey | LIOOXTZMYZZGOG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |