C12H16ClN3O2 — CID 171316039
3,5-dimethoxy-N-(1H-pyrazol-5-ylmethyl)aniline;hydrochloride (PubChem CID 171316039) has the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. Its IUPAC name is 3,5-dimethoxy-N-(1H-pyrazol-5-ylmethyl)aniline;hydrochloride.
| Compound Name | 3,5-dimethoxy-N-(1H-pyrazol-5-ylmethyl)aniline;hydrochloride |
|---|---|
| PubChem CID | 171316039 |
| Molecular Formula | C12H16ClN3O2 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 3,5-dimethoxy-N-(1H-pyrazol-5-ylmethyl)aniline;hydrochloride |
| SMILES | COc1cc(NCc2ccn[nH]2)cc(OC)c1.Cl |
| InChI | InChI=1S/C12H15N3O2.ClH/c1-16-11-5-10(6-12(7-11)17-2)13-8-9-3-4-14-15-9;/h3-7,13H,8H2,1-2H3,(H,14,15);1H |
| InChIKey | WKUPRGKYSYDUJF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |