C10H11FN4 — CID 61285074
5-fluoro-3-N-(1H-pyrazol-5-ylmethyl)benzene-1,3-diamine (PubChem CID 61285074) has the molecular formula C10H11FN4 and a molecular weight of 206.22 g/mol. Its IUPAC name is 5-fluoro-3-N-(1H-pyrazol-5-ylmethyl)benzene-1,3-diamine.
| Compound Name | 5-fluoro-3-N-(1H-pyrazol-5-ylmethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 61285074 |
| Molecular Formula | C10H11FN4 |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 5-fluoro-3-N-(1H-pyrazol-5-ylmethyl)benzene-1,3-diamine |
| SMILES | Nc1cc(F)cc(NCc2ccn[nH]2)c1 |
| InChI | InChI=1S/C10H11FN4/c11-7-3-8(12)5-10(4-7)13-6-9-1-2-14-15-9/h1-5,13H,6,12H2,(H,14,15) |
| InChIKey | QJAUSWIYWDXDGH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|