C9H10FN5 — CID 64546495
5-fluoro-3-N-(1H-1,2,4-triazol-5-ylmethyl)benzene-1,3-diamine (PubChem CID 64546495) has the molecular formula C9H10FN5 and a molecular weight of 207.21 g/mol. Its IUPAC name is 5-fluoro-3-N-(1H-1,2,4-triazol-5-ylmethyl)benzene-1,3-diamine.
| Compound Name | 5-fluoro-3-N-(1H-1,2,4-triazol-5-ylmethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 64546495 |
| Molecular Formula | C9H10FN5 |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 5-fluoro-3-N-(1H-1,2,4-triazol-5-ylmethyl)benzene-1,3-diamine |
| SMILES | Nc1cc(F)cc(NCc2ncn[nH]2)c1 |
| InChI | InChI=1S/C9H10FN5/c10-6-1-7(11)3-8(2-6)12-4-9-13-5-14-15-9/h1-3,5,12H,4,11H2,(H,13,14,15) |
| InChIKey | RNBIAXQFPGZNOC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|