C8H8BrN5 — CID 106193127
5-bromo-N-(1H-1,2,4-triazol-5-ylmethyl)pyridin-3-amine (PubChem CID 106193127) has the molecular formula C8H8BrN5 and a molecular weight of 254.09 g/mol. Its IUPAC name is 5-bromo-N-(1H-1,2,4-triazol-5-ylmethyl)pyridin-3-amine.
| Compound Name | 5-bromo-N-(1H-1,2,4-triazol-5-ylmethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 106193127 |
| Molecular Formula | C8H8BrN5 |
| Molecular Weight | 254.09 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | 5-bromo-N-(1H-1,2,4-triazol-5-ylmethyl)pyridin-3-amine |
| SMILES | Brc1cncc(NCc2ncn[nH]2)c1 |
| InChI | InChI=1S/C8H8BrN5/c9-6-1-7(3-10-2-6)11-4-8-12-5-13-14-8/h1-3,5,11H,4H2,(H,12,13,14) |
| InChIKey | HRQNLMPZXJLRIC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.09 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |