C10H11F2N5 — CID 64546890
2-(difluoromethyl)-1-N-(1H-1,2,4-triazol-5-ylmethyl)benzene-1,4-diamine (PubChem CID 64546890) has the molecular formula C10H11F2N5 and a molecular weight of 239.23 g/mol. Its IUPAC name is 2-(difluoromethyl)-1-N-(1H-1,2,4-triazol-5-ylmethyl)benzene-1,4-diamine.
| Compound Name | 2-(difluoromethyl)-1-N-(1H-1,2,4-triazol-5-ylmethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 64546890 |
| Molecular Formula | C10H11F2N5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 2-(difluoromethyl)-1-N-(1H-1,2,4-triazol-5-ylmethyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(NCc2ncn[nH]2)c(C(F)F)c1 |
| InChI | InChI=1S/C10H11F2N5/c11-10(12)7-3-6(13)1-2-8(7)14-4-9-15-5-16-17-9/h1-3,5,10,14H,4,13H2,(H,15,16,17) |
| InChIKey | SXCDVFNEZBAQSZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|