C11H14N4 — CID 62911967
4-methyl-1-N-(1H-pyrazol-5-ylmethyl)benzene-1,3-diamine (PubChem CID 62911967) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 4-methyl-1-N-(1H-pyrazol-5-ylmethyl)benzene-1,3-diamine.
| Compound Name | 4-methyl-1-N-(1H-pyrazol-5-ylmethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 62911967 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 4-methyl-1-N-(1H-pyrazol-5-ylmethyl)benzene-1,3-diamine |
| SMILES | Cc1ccc(NCc2ccn[nH]2)cc1N |
| InChI | InChI=1S/C11H14N4/c1-8-2-3-9(6-11(8)12)13-7-10-4-5-14-15-10/h2-6,13H,7,12H2,1H3,(H,14,15) |
| InChIKey | SUVMYHQZZTWCCM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|