C12H11BrFN3 — CID 113368317
4-N-[(2-bromo-5-fluorophenyl)methyl]pyridine-2,4-diamine (PubChem CID 113368317) has the molecular formula C12H11BrFN3 and a molecular weight of 296.14 g/mol. Its IUPAC name is 4-N-[(2-bromo-5-fluorophenyl)methyl]pyridine-2,4-diamine.
| Compound Name | 4-N-[(2-bromo-5-fluorophenyl)methyl]pyridine-2,4-diamine |
|---|---|
| PubChem CID | 113368317 |
| Molecular Formula | C12H11BrFN3 |
| Molecular Weight | 296.14 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | 4-N-[(2-bromo-5-fluorophenyl)methyl]pyridine-2,4-diamine |
| SMILES | Nc1cc(NCc2cc(F)ccc2Br)ccn1 |
| InChI | InChI=1S/C12H11BrFN3/c13-11-2-1-9(14)5-8(11)7-17-10-3-4-16-12(15)6-10/h1-6H,7H2,(H3,15,16,17) |
| InChIKey | HOVKFEYRHYRHCS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.14 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |