C12H9Br2FN2 — CID 113452010
3-bromo-N-[(2-bromo-5-fluorophenyl)methyl]pyridin-4-amine (PubChem CID 113452010) has the molecular formula C12H9Br2FN2 and a molecular weight of 360.02 g/mol. Its IUPAC name is 3-bromo-N-[(2-bromo-5-fluorophenyl)methyl]pyridin-4-amine.
| Compound Name | 3-bromo-N-[(2-bromo-5-fluorophenyl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 113452010 |
| Molecular Formula | C12H9Br2FN2 |
| Molecular Weight | 360.02 g/mol |
| Exact Mass | 357.91 |
| IUPAC Name | 3-bromo-N-[(2-bromo-5-fluorophenyl)methyl]pyridin-4-amine |
| SMILES | Fc1ccc(Br)c(CNc2ccncc2Br)c1 |
| InChI | InChI=1S/C12H9Br2FN2/c13-10-2-1-9(15)5-8(10)6-17-12-3-4-16-7-11(12)14/h1-5,7H,6H2,(H,16,17) |
| InChIKey | KRWBIGHQVPQGMK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.02 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |