C12H9BrF2N2 — CID 113452020
3-bromo-N-[(3,4-difluorophenyl)methyl]pyridin-4-amine (PubChem CID 113452020) has the molecular formula C12H9BrF2N2 and a molecular weight of 299.12 g/mol. Its IUPAC name is 3-bromo-N-[(3,4-difluorophenyl)methyl]pyridin-4-amine.
| Compound Name | 3-bromo-N-[(3,4-difluorophenyl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 113452020 |
| Molecular Formula | C12H9BrF2N2 |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 3-bromo-N-[(3,4-difluorophenyl)methyl]pyridin-4-amine |
| SMILES | Fc1ccc(CNc2ccncc2Br)cc1F |
| InChI | InChI=1S/C12H9BrF2N2/c13-9-7-16-4-3-12(9)17-6-8-1-2-10(14)11(15)5-8/h1-5,7H,6H2,(H,16,17) |
| InChIKey | JAYZRZITHOWTQT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |