C13H12Cl2N2O3S — CID 115951518
4-chloro-3-[(3-chloro-2-hydroxyphenyl)methylamino]benzenesulfonamide (PubChem CID 115951518) has the molecular formula C13H12Cl2N2O3S and a molecular weight of 347.22 g/mol. Its IUPAC name is 4-chloro-3-[(3-chloro-2-hydroxyphenyl)methylamino]benzenesulfonamide.
| Compound Name | 4-chloro-3-[(3-chloro-2-hydroxyphenyl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 115951518 |
| Molecular Formula | C13H12Cl2N2O3S |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 4-chloro-3-[(3-chloro-2-hydroxyphenyl)methylamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Cl)c(NCc2cccc(Cl)c2O)c1 |
| InChI | InChI=1S/C13H12Cl2N2O3S/c14-10-5-4-9(21(16,19)20)6-12(10)17-7-8-2-1-3-11(15)13(8)18/h1-6,17-18H,7H2,(H2,16,19,20) |
| InChIKey | JYJOQRJJKYGKIU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|