C17H21N3O — CID 43744507
[3-[(2,4,6-trimethylphenyl)methylamino]phenyl]urea (PubChem CID 43744507) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is [3-[(2,4,6-trimethylphenyl)methylamino]phenyl]urea.
| Compound Name | [3-[(2,4,6-trimethylphenyl)methylamino]phenyl]urea |
|---|---|
| PubChem CID | 43744507 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | [3-[(2,4,6-trimethylphenyl)methylamino]phenyl]urea |
| SMILES | Cc1cc(C)c(CNc2cccc(NC(N)=O)c2)c(C)c1 |
| InChI | InChI=1S/C17H21N3O/c1-11-7-12(2)16(13(3)8-11)10-19-14-5-4-6-15(9-14)20-17(18)21/h4-9,19H,10H2,1-3H3,(H3,18,20,21) |
| InChIKey | RZCBMGSXUATYBI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |