C10H11N3O — CID 63951484
[3-(prop-2-ynylamino)phenyl]urea (PubChem CID 63951484) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is [3-(prop-2-ynylamino)phenyl]urea.
| Compound Name | [3-(prop-2-ynylamino)phenyl]urea |
|---|---|
| PubChem CID | 63951484 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | [3-(prop-2-ynylamino)phenyl]urea |
| SMILES | C#CCNc1cccc(NC(N)=O)c1 |
| InChI | InChI=1S/C10H11N3O/c1-2-6-12-8-4-3-5-9(7-8)13-10(11)14/h1,3-5,7,12H,6H2,(H3,11,13,14) |
| InChIKey | CPDUCZHVFWRLSH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|