C13H15N3O3 — CID 64591407
[3-[[5-(hydroxymethyl)furan-2-yl]methylamino]phenyl]urea (PubChem CID 64591407) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is [3-[[5-(hydroxymethyl)furan-2-yl]methylamino]phenyl]urea.
| Compound Name | [3-[[5-(hydroxymethyl)furan-2-yl]methylamino]phenyl]urea |
|---|---|
| PubChem CID | 64591407 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | [3-[[5-(hydroxymethyl)furan-2-yl]methylamino]phenyl]urea |
| SMILES | NC(=O)Nc1cccc(NCc2ccc(CO)o2)c1 |
| InChI | InChI=1S/C13H15N3O3/c14-13(18)16-10-3-1-2-9(6-10)15-7-11-4-5-12(8-17)19-11/h1-6,15,17H,7-8H2,(H3,14,16,18) |
| InChIKey | GIMJZYBAVVLXBW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |