C18H22N2O — CID 43724074
2-[4-[(2,4,6-trimethylphenyl)methylamino]phenyl]acetamide (PubChem CID 43724074) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-[4-[(2,4,6-trimethylphenyl)methylamino]phenyl]acetamide.
| Compound Name | 2-[4-[(2,4,6-trimethylphenyl)methylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 43724074 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2-[4-[(2,4,6-trimethylphenyl)methylamino]phenyl]acetamide |
| SMILES | Cc1cc(C)c(CNc2ccc(CC(N)=O)cc2)c(C)c1 |
| InChI | InChI=1S/C18H22N2O/c1-12-8-13(2)17(14(3)9-12)11-20-16-6-4-15(5-7-16)10-18(19)21/h4-9,20H,10-11H2,1-3H3,(H2,19,21) |
| InChIKey | MUQCPHBVKCWRGY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |