About 2-[4-[(2,4,6-trimethylphenyl)methylamino]phenyl]acetamide
2-[4-[(2,4,6-trimethylphenyl)methylamino]phenyl]acetamide (PubChem CID 43724074) has the molecular formula C18H22N2O
and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-[4-[(2,4,6-trimethylphenyl)methylamino]phenyl]acetamide.
Molecular Properties
| Compound Name | 2-[4-[(2,4,6-trimethylphenyl)methylamino]phenyl]acetamide |
| PubChem CID | 43724074 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2-[4-[(2,4,6-trimethylphenyl)methylamino]phenyl]acetamide |
| SMILES | Cc1cc(C)c(CNc2ccc(CC(N)=O)cc2)c(C)c1 |
| InChI | InChI=1S/C18H22N2O/c1-12-8-13(2)17(14(3)9-12)11-20-16-6-4-15(5-7-16)10-18(19)21/h4-9,20H,10-11H2,1-3H3,(H2,19,21) |
| InChIKey | MUQCPHBVKCWRGY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-[(2,4,6-trimethylphenyl)methylamino]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(2,4,6-trimethylphenyl)methylamino]phenyl]acetamide?
The IUPAC name of 2-[4-[(2,4,6-trimethylphenyl)methylamino]phenyl]acetamide (CID 43724074) is 2-[4-[(2,4,6-trimethylphenyl)methylamino]phenyl]acetamide.
What is the SMILES notation for 2-[4-[(2,4,6-trimethylphenyl)methylamino]phenyl]acetamide?
The canonical SMILES for 2-[4-[(2,4,6-trimethylphenyl)methylamino]phenyl]acetamide is Cc1cc(C)c(CNc2ccc(CC(N)=O)cc2)c(C)c1.
What is the InChIKey of 2-[4-[(2,4,6-trimethylphenyl)methylamino]phenyl]acetamide?
The InChIKey is MUQCPHBVKCWRGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O/c1-12-8-13(2)17(14(3)9-12)11-20-16-6-4-15(5-7-16)10-18(19)21/h4-9,20H,10-11H2,1-3H3,(H2,19,21).
What are the key properties of 2-[4-[(2,4,6-trimethylphenyl)methylamino]phenyl]acetamide?
2-[4-[(2,4,6-trimethylphenyl)methylamino]phenyl]acetamide has a molecular weight of 282.39 g/mol, XLogP of 3.25, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2,4,6-trimethylphenyl)methylamino]phenyl]acetamide is sourced from PubChem (CID 43724074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).