C15H24N2O — CID 114200586
2-[4-(2,4-dimethylpentylamino)phenyl]acetamide (PubChem CID 114200586) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-[4-(2,4-dimethylpentylamino)phenyl]acetamide.
| Compound Name | 2-[4-(2,4-dimethylpentylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 114200586 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 2-[4-(2,4-dimethylpentylamino)phenyl]acetamide |
| SMILES | CC(C)CC(C)CNc1ccc(CC(N)=O)cc1 |
| InChI | InChI=1S/C15H24N2O/c1-11(2)8-12(3)10-17-14-6-4-13(5-7-14)9-15(16)18/h4-7,11-12,17H,8-10H2,1-3H3,(H2,16,18) |
| InChIKey | STLXQKIBABDZRI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |