C12H19NO4S2 — CID 117490792
1-[3,4-bis(methylsulfonyl)phenyl]-2-methylpropan-2-amine (PubChem CID 117490792) has the molecular formula C12H19NO4S2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 1-[3,4-bis(methylsulfonyl)phenyl]-2-methylpropan-2-amine.
| Compound Name | 1-[3,4-bis(methylsulfonyl)phenyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 117490792 |
| Molecular Formula | C12H19NO4S2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 1-[3,4-bis(methylsulfonyl)phenyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(N)Cc1ccc(S(C)(=O)=O)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C12H19NO4S2/c1-12(2,13)8-9-5-6-10(18(3,14)15)11(7-9)19(4,16)17/h5-7H,8,13H2,1-4H3 |
| InChIKey | APGUBNBTTSYSDT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |