C10H16N2O8S4 — CID 163361981
4-[[bis(methylsulfonyl)amino]methyl]-2-methylsulfonylbenzenesulfonamide (PubChem CID 163361981) has the molecular formula C10H16N2O8S4 and a molecular weight of 420.51 g/mol. Its IUPAC name is 4-[[bis(methylsulfonyl)amino]methyl]-2-methylsulfonylbenzenesulfonamide.
| Compound Name | 4-[[bis(methylsulfonyl)amino]methyl]-2-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 163361981 |
| Molecular Formula | C10H16N2O8S4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 419.98 |
| IUPAC Name | 4-[[bis(methylsulfonyl)amino]methyl]-2-methylsulfonylbenzenesulfonamide |
| SMILES | CS(=O)(=O)c1cc(CN(S(C)(=O)=O)S(C)(=O)=O)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C10H16N2O8S4/c1-21(13,14)10-6-8(4-5-9(10)24(11,19)20)7-12(22(2,15)16)23(3,17)18/h4-6H,7H2,1-3H3,(H2,11,19,20) |
| InChIKey | OKCPKWMZVGAYNQ-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 165.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |