C21H29NO4S2 — CID 157187047
4-[4-[4-(tert-butylsulfonylmethyl)phenyl]butyl]benzenesulfonamide (PubChem CID 157187047) has the molecular formula C21H29NO4S2 and a molecular weight of 423.60 g/mol. Its IUPAC name is 4-[4-[4-(tert-butylsulfonylmethyl)phenyl]butyl]benzenesulfonamide.
| Compound Name | 4-[4-[4-(tert-butylsulfonylmethyl)phenyl]butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 157187047 |
| Molecular Formula | C21H29NO4S2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 4-[4-[4-(tert-butylsulfonylmethyl)phenyl]butyl]benzenesulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)Cc1ccc(CCCCc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C21H29NO4S2/c1-21(2,3)27(23,24)16-19-10-8-17(9-11-19)6-4-5-7-18-12-14-20(15-13-18)28(22,25)26/h8-15H,4-7,16H2,1-3H3,(H2,22,25,26) |
| InChIKey | AWXIDAPFESOQSS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|