C20H27NO4S2 — CID 159770469
N-[4-[2-[4-(tert-butylsulfonylmethyl)phenyl]ethyl]phenyl]methanesulfonamide (PubChem CID 159770469) has the molecular formula C20H27NO4S2 and a molecular weight of 409.57 g/mol. Its IUPAC name is N-[4-[2-[4-(tert-butylsulfonylmethyl)phenyl]ethyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[2-[4-(tert-butylsulfonylmethyl)phenyl]ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 159770469 |
| Molecular Formula | C20H27NO4S2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | N-[4-[2-[4-(tert-butylsulfonylmethyl)phenyl]ethyl]phenyl]methanesulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)Cc1ccc(CCc2ccc(NS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C20H27NO4S2/c1-20(2,3)27(24,25)15-18-9-7-16(8-10-18)5-6-17-11-13-19(14-12-17)21-26(4,22)23/h7-14,21H,5-6,15H2,1-4H3 |
| InChIKey | SHAWUNHHVJXPTJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |