C20H29KN2O3S — CID 142885263
potassium;2-(4-tert-butylphenyl)ethyl-hydroxyazanide;N-(4-methylphenyl)methanesulfonamide (PubChem CID 142885263) has the molecular formula C20H29KN2O3S and a molecular weight of 416.63 g/mol. Its IUPAC name is potassium;2-(4-tert-butylphenyl)ethyl-hydroxyazanide;N-(4-methylphenyl)methanesulfonamide.
| Compound Name | potassium;2-(4-tert-butylphenyl)ethyl-hydroxyazanide;N-(4-methylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 142885263 |
| Molecular Formula | C20H29KN2O3S |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | potassium;2-(4-tert-butylphenyl)ethyl-hydroxyazanide;N-(4-methylphenyl)methanesulfonamide |
| SMILES | CC(C)(C)c1ccc(CC[N-]O)cc1.Cc1ccc(NS(C)(=O)=O)cc1.[K+] |
| InChI | InChI=1S/C12H18NO.C8H11NO2S.K/c1-12(2,3)11-6-4-10(5-7-11)8-9-13-14;1-7-3-5-8(6-4-7)9-12(2,10)11;/h4-7,14H,8-9H2,1-3H3;3-6,9H,1-2H3;/q-1;;+1 |
| InChIKey | RSIGDBWMNKGCAJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 80.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|