C22H30N2O2S2 — CID 87894228
3-(4-tert-butylphenyl)-N-[2-[4-(methanesulfonamido)phenyl]ethyl]propanethioamide (PubChem CID 87894228) has the molecular formula C22H30N2O2S2 and a molecular weight of 418.63 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-N-[2-[4-(methanesulfonamido)phenyl]ethyl]propanethioamide.
| Compound Name | 3-(4-tert-butylphenyl)-N-[2-[4-(methanesulfonamido)phenyl]ethyl]propanethioamide |
|---|---|
| PubChem CID | 87894228 |
| Molecular Formula | C22H30N2O2S2 |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 3-(4-tert-butylphenyl)-N-[2-[4-(methanesulfonamido)phenyl]ethyl]propanethioamide |
| SMILES | CC(C)(C)c1ccc(CCC(=S)NCCc2ccc(NS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C22H30N2O2S2/c1-22(2,3)19-10-5-17(6-11-19)9-14-21(27)23-16-15-18-7-12-20(13-8-18)24-28(4,25)26/h5-8,10-13,24H,9,14-16H2,1-4H3,(H,23,27) |
| InChIKey | FAQGNGBMZWSGCT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|