C21H25FN2O2S2 — CID 11855312
(Z)-3-(4-tert-butylphenyl)-2-fluoro-N-[[4-(methanesulfonamido)phenyl]methyl]prop-2-enethioamide (PubChem CID 11855312) has the molecular formula C21H25FN2O2S2 and a molecular weight of 420.58 g/mol. Its IUPAC name is (Z)-3-(4-tert-butylphenyl)-2-fluoro-N-[[4-(methanesulfonamido)phenyl]methyl]prop-2-enethioamide.
| Compound Name | (Z)-3-(4-tert-butylphenyl)-2-fluoro-N-[[4-(methanesulfonamido)phenyl]methyl]prop-2-enethioamide |
|---|---|
| PubChem CID | 11855312 |
| Molecular Formula | C21H25FN2O2S2 |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | (Z)-3-(4-tert-butylphenyl)-2-fluoro-N-[[4-(methanesulfonamido)phenyl]methyl]prop-2-enethioamide |
| SMILES | CC(C)(C)c1ccc(/C=C(\F)C(=S)NCc2ccc(NS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C21H25FN2O2S2/c1-21(2,3)17-9-5-15(6-10-17)13-19(22)20(27)23-14-16-7-11-18(12-8-16)24-28(4,25)26/h5-13,24H,14H2,1-4H3,(H,23,27)/b19-13- |
| InChIKey | CSBSQIZVSKELJT-UYRXBGFRSA-N |
| XLogP | 4.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|