C22H33N3O2S2Si — CID 46229465
1-[[4-(methanesulfonamido)phenyl]methyl]-3-[(4-triethylsilylphenyl)methyl]thiourea (PubChem CID 46229465) has the molecular formula C22H33N3O2S2Si and a molecular weight of 463.75 g/mol. Its IUPAC name is 1-[[4-(methanesulfonamido)phenyl]methyl]-3-[(4-triethylsilylphenyl)methyl]thiourea.
| Compound Name | 1-[[4-(methanesulfonamido)phenyl]methyl]-3-[(4-triethylsilylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 46229465 |
| Molecular Formula | C22H33N3O2S2Si |
| Molecular Weight | 463.75 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 1-[[4-(methanesulfonamido)phenyl]methyl]-3-[(4-triethylsilylphenyl)methyl]thiourea |
| SMILES | CC[Si](CC)(CC)c1ccc(CNC(=S)NCc2ccc(NS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C22H33N3O2S2Si/c1-5-30(6-2,7-3)21-14-10-19(11-15-21)17-24-22(28)23-16-18-8-12-20(13-9-18)25-29(4,26)27/h8-15,25H,5-7,16-17H2,1-4H3,(H2,23,24,28) |
| InChIKey | SSNZAKDSKQRETB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.75 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|