C16H22N4O2S2 — CID 59088066
1-[[4-(methanesulfonamido)phenyl]methyl]-3-[2-(1-methylpyrrol-2-yl)ethyl]thiourea (PubChem CID 59088066) has the molecular formula C16H22N4O2S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 1-[[4-(methanesulfonamido)phenyl]methyl]-3-[2-(1-methylpyrrol-2-yl)ethyl]thiourea.
| Compound Name | 1-[[4-(methanesulfonamido)phenyl]methyl]-3-[2-(1-methylpyrrol-2-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 59088066 |
| Molecular Formula | C16H22N4O2S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 1-[[4-(methanesulfonamido)phenyl]methyl]-3-[2-(1-methylpyrrol-2-yl)ethyl]thiourea |
| SMILES | Cn1cccc1CCNC(=S)NCc1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H22N4O2S2/c1-20-11-3-4-15(20)9-10-17-16(23)18-12-13-5-7-14(8-6-13)19-24(2,21)22/h3-8,11,19H,9-10,12H2,1-2H3,(H2,17,18,23) |
| InChIKey | XPSFJSHFUNVVEC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 75.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|