C17H20FN3O2S2 — CID 10156688
1-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-(2-phenylethyl)thiourea (PubChem CID 10156688) has the molecular formula C17H20FN3O2S2 and a molecular weight of 381.50 g/mol. Its IUPAC name is 1-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-(2-phenylethyl)thiourea.
| Compound Name | 1-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 10156688 |
| Molecular Formula | C17H20FN3O2S2 |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 1-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-(2-phenylethyl)thiourea |
| SMILES | CS(=O)(=O)Nc1ccc(CNC(=S)NCCc2ccccc2)cc1F |
| InChI | InChI=1S/C17H20FN3O2S2/c1-25(22,23)21-16-8-7-14(11-15(16)18)12-20-17(24)19-10-9-13-5-3-2-4-6-13/h2-8,11,21H,9-10,12H2,1H3,(H2,19,20,24) |
| InChIKey | NZCNYRMFPBIETM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|