C20H20FN3O2S2 — CID 11683150
1-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-(naphthalen-1-ylmethyl)thiourea (PubChem CID 11683150) has the molecular formula C20H20FN3O2S2 and a molecular weight of 417.53 g/mol. Its IUPAC name is 1-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-(naphthalen-1-ylmethyl)thiourea.
| Compound Name | 1-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-(naphthalen-1-ylmethyl)thiourea |
|---|---|
| PubChem CID | 11683150 |
| Molecular Formula | C20H20FN3O2S2 |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 1-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-(naphthalen-1-ylmethyl)thiourea |
| SMILES | CS(=O)(=O)Nc1ccc(CNC(=S)NCc2cccc3ccccc23)cc1F |
| InChI | InChI=1S/C20H20FN3O2S2/c1-28(25,26)24-19-10-9-14(11-18(19)21)12-22-20(27)23-13-16-7-4-6-15-5-2-3-8-17(15)16/h2-11,24H,12-13H2,1H3,(H2,22,23,27) |
| InChIKey | SZGMJYDZLQPUBU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|