C23H31FN2O2S2 — CID 11856129
2-[(4-tert-butylphenyl)methyl]-N-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]butanethioamide (PubChem CID 11856129) has the molecular formula C23H31FN2O2S2 and a molecular weight of 450.65 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)methyl]-N-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]butanethioamide.
| Compound Name | 2-[(4-tert-butylphenyl)methyl]-N-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]butanethioamide |
|---|---|
| PubChem CID | 11856129 |
| Molecular Formula | C23H31FN2O2S2 |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 2-[(4-tert-butylphenyl)methyl]-N-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]butanethioamide |
| SMILES | CCC(Cc1ccc(C(C)(C)C)cc1)C(=S)NCc1ccc(NS(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C23H31FN2O2S2/c1-6-18(13-16-7-10-19(11-8-16)23(2,3)4)22(29)25-15-17-9-12-21(20(24)14-17)26-30(5,27)28/h7-12,14,18,26H,6,13,15H2,1-5H3,(H,25,29) |
| InChIKey | UKWKYWUTVCIBPK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|