C23H30AsFNO2S2 — CID 87895954
CID 87895954 (PubChem CID 87895954) has the molecular formula C23H30AsFNO2S2 and a molecular weight of 510.55 g/mol.
| Compound Name | CID 87895954 |
|---|---|
| PubChem CID | 87895954 |
| Molecular Formula | C23H30AsFNO2S2 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | — |
| SMILES | CCC(Cc1ccc(C(C)(C)C)cc1)C(=S)NCc1ccc([As]S(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C23H30AsFNO2S2/c1-6-18(13-16-7-10-19(11-8-16)23(2,3)4)22(29)26-15-17-9-12-20(21(25)14-17)24-30(5,27)28/h7-12,14,18H,6,13,15H2,1-5H3,(H,26,29) |
| InChIKey | URXFURCTFAHLOM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|