C19H21F3N2S — CID 59088087
1-[(4-tert-butylphenyl)methyl]-3-[(2,3,6-trifluorophenyl)methyl]thiourea (PubChem CID 59088087) has the molecular formula C19H21F3N2S and a molecular weight of 366.45 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-3-[(2,3,6-trifluorophenyl)methyl]thiourea.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-3-[(2,3,6-trifluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 59088087 |
| Molecular Formula | C19H21F3N2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-3-[(2,3,6-trifluorophenyl)methyl]thiourea |
| SMILES | CC(C)(C)c1ccc(CNC(=S)NCc2c(F)ccc(F)c2F)cc1 |
| InChI | InChI=1S/C19H21F3N2S/c1-19(2,3)13-6-4-12(5-7-13)10-23-18(25)24-11-14-15(20)8-9-16(21)17(14)22/h4-9H,10-11H2,1-3H3,(H2,23,24,25) |
| InChIKey | NZCFENRTZVOPBO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|