C21H27N3O2S2 — CID 88873296
aminosulfanyl 4-[2-[(4-tert-butylphenyl)methylcarbamothioylamino]ethyl]benzoate (PubChem CID 88873296) has the molecular formula C21H27N3O2S2 and a molecular weight of 417.60 g/mol. Its IUPAC name is aminosulfanyl 4-[2-[(4-tert-butylphenyl)methylcarbamothioylamino]ethyl]benzoate.
| Compound Name | aminosulfanyl 4-[2-[(4-tert-butylphenyl)methylcarbamothioylamino]ethyl]benzoate |
|---|---|
| PubChem CID | 88873296 |
| Molecular Formula | C21H27N3O2S2 |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | aminosulfanyl 4-[2-[(4-tert-butylphenyl)methylcarbamothioylamino]ethyl]benzoate |
| SMILES | CC(C)(C)c1ccc(CNC(=S)NCCc2ccc(C(=O)OSN)cc2)cc1 |
| InChI | InChI=1S/C21H27N3O2S2/c1-21(2,3)18-10-6-16(7-11-18)14-24-20(27)23-13-12-15-4-8-17(9-5-15)19(25)26-28-22/h4-11H,12-14,22H2,1-3H3,(H2,23,24,27) |
| InChIKey | DUKRRSRQVHJMKE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|