C24H30N2O4 — CID 46449947
methyl 4-[2-[2-[(4-tert-butylbenzoyl)amino]propanoylamino]ethyl]benzoate (PubChem CID 46449947) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is methyl 4-[2-[2-[(4-tert-butylbenzoyl)amino]propanoylamino]ethyl]benzoate.
| Compound Name | methyl 4-[2-[2-[(4-tert-butylbenzoyl)amino]propanoylamino]ethyl]benzoate |
|---|---|
| PubChem CID | 46449947 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | methyl 4-[2-[2-[(4-tert-butylbenzoyl)amino]propanoylamino]ethyl]benzoate |
| SMILES | COC(=O)c1ccc(CCNC(=O)C(C)NC(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H30N2O4/c1-16(26-22(28)18-10-12-20(13-11-18)24(2,3)4)21(27)25-15-14-17-6-8-19(9-7-17)23(29)30-5/h6-13,16H,14-15H2,1-5H3,(H,25,27)(H,26,28) |
| InChIKey | AQVYPRNBVLSYPF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |