C25H33NO5 — CID 144758508
ethane;methyl 4-[2-[(4-tert-butylbenzoyl)amino]-3-methoxy-3-oxopropyl]benzoate (PubChem CID 144758508) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is ethane;methyl 4-[2-[(4-tert-butylbenzoyl)amino]-3-methoxy-3-oxopropyl]benzoate.
| Compound Name | ethane;methyl 4-[2-[(4-tert-butylbenzoyl)amino]-3-methoxy-3-oxopropyl]benzoate |
|---|---|
| PubChem CID | 144758508 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | ethane;methyl 4-[2-[(4-tert-butylbenzoyl)amino]-3-methoxy-3-oxopropyl]benzoate |
| SMILES | CC.COC(=O)c1ccc(CC(NC(=O)c2ccc(C(C)(C)C)cc2)C(=O)OC)cc1 |
| InChI | InChI=1S/C23H27NO5.C2H6/c1-23(2,3)18-12-10-16(11-13-18)20(25)24-19(22(27)29-5)14-15-6-8-17(9-7-15)21(26)28-4;1-2/h6-13,19H,14H2,1-5H3,(H,24,25);1-2H3 |
| InChIKey | GIKUDWRSRQIQGM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |