C30H33NO5 — CID 58546052
[4-[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-oxobutyl]phenyl] 4-ethoxybenzoate (PubChem CID 58546052) has the molecular formula C30H33NO5 and a molecular weight of 487.60 g/mol. Its IUPAC name is [4-[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-oxobutyl]phenyl] 4-ethoxybenzoate.
| Compound Name | [4-[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-oxobutyl]phenyl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 58546052 |
| Molecular Formula | C30H33NO5 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | [4-[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-oxobutyl]phenyl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(C[C@H](NC(=O)c3ccc(C(C)(C)C)cc3)C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C30H33NO5/c1-6-35-25-17-11-23(12-18-25)29(34)36-26-15-7-21(8-16-26)19-27(20(2)32)31-28(33)22-9-13-24(14-10-22)30(3,4)5/h7-18,27H,6,19H2,1-5H3,(H,31,33)/t27-/m0/s1 |
| InChIKey | QOKIZPALDOGDJP-MHZLTWQESA-N |
| XLogP | 5.53 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|