C33H32N2O4 — CID 58546053
[4-[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-oxobutyl]phenyl] 4-pyridin-3-ylbenzoate (PubChem CID 58546053) has the molecular formula C33H32N2O4 and a molecular weight of 520.63 g/mol. Its IUPAC name is [4-[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-oxobutyl]phenyl] 4-pyridin-3-ylbenzoate.
| Compound Name | [4-[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-oxobutyl]phenyl] 4-pyridin-3-ylbenzoate |
|---|---|
| PubChem CID | 58546053 |
| Molecular Formula | C33H32N2O4 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | [4-[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-oxobutyl]phenyl] 4-pyridin-3-ylbenzoate |
| SMILES | CC(=O)[C@H](Cc1ccc(OC(=O)c2ccc(-c3cccnc3)cc2)cc1)NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C33H32N2O4/c1-22(36)30(35-31(37)25-13-15-28(16-14-25)33(2,3)4)20-23-7-17-29(18-8-23)39-32(38)26-11-9-24(10-12-26)27-6-5-19-34-21-27/h5-19,21,30H,20H2,1-4H3,(H,35,37)/t30-/m0/s1 |
| InChIKey | QWSABTNJEGOAIM-PMERELPUSA-N |
| XLogP | 6.20 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|