C37H43N3O4 — CID 86582069
(2S)-2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoic acid (PubChem CID 86582069) has the molecular formula C37H43N3O4 and a molecular weight of 593.77 g/mol. Its IUPAC name is (2S)-2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoic acid.
| Compound Name | (2S)-2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 86582069 |
| Molecular Formula | C37H43N3O4 |
| Molecular Weight | 593.77 g/mol |
| Exact Mass | 593.33 |
| IUPAC Name | (2S)-2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(C[C@H](NC(=O)c4ccc(C(C)(C)C)cc4)C(=O)O)cc3)nc2)cc1 |
| InChI | InChI=1S/C37H43N3O4/c1-5-6-7-8-9-22-44-32-20-16-27(17-21-32)30-24-38-34(39-25-30)28-12-10-26(11-13-28)23-33(36(42)43)40-35(41)29-14-18-31(19-15-29)37(2,3)4/h10-21,24-25,33H,5-9,22-23H2,1-4H3,(H,40,41)(H,42,43)/t33-/m0/s1 |
| InChIKey | QNWBBCXQNBPJBJ-XIFFEERXSA-N |
| XLogP | 7.88 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.77 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|