C35H39N3O4 — CID 123527304
2-[(4-ethylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoic acid (PubChem CID 123527304) has the molecular formula C35H39N3O4 and a molecular weight of 565.71 g/mol. Its IUPAC name is 2-[(4-ethylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoic acid.
| Compound Name | 2-[(4-ethylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 123527304 |
| Molecular Formula | C35H39N3O4 |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.29 |
| IUPAC Name | 2-[(4-ethylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(NC(=O)c4ccc(CC)cc4)C(=O)O)cc3)nc2)cc1 |
| InChI | InChI=1S/C35H39N3O4/c1-3-5-6-7-8-21-42-31-19-17-27(18-20-31)30-23-36-33(37-24-30)28-13-11-26(12-14-28)22-32(35(40)41)38-34(39)29-15-9-25(4-2)10-16-29/h9-20,23-24,32H,3-8,21-22H2,1-2H3,(H,38,39)(H,40,41) |
| InChIKey | NNWLCFDTPXEKPD-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|