C34H39N3O4S — CID 123149072
3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-2-[(5-propan-2-ylthiophene-2-carbonyl)amino]propanoic acid (PubChem CID 123149072) has the molecular formula C34H39N3O4S and a molecular weight of 585.77 g/mol. Its IUPAC name is 3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-2-[(5-propan-2-ylthiophene-2-carbonyl)amino]propanoic acid.
| Compound Name | 3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-2-[(5-propan-2-ylthiophene-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 123149072 |
| Molecular Formula | C34H39N3O4S |
| Molecular Weight | 585.77 g/mol |
| Exact Mass | 585.27 |
| IUPAC Name | 3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-2-[(5-propan-2-ylthiophene-2-carbonyl)amino]propanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(NC(=O)c4ccc(C(C)C)s4)C(=O)O)cc3)nc2)cc1 |
| InChI | InChI=1S/C34H39N3O4S/c1-4-5-6-7-8-19-41-28-15-13-25(14-16-28)27-21-35-32(36-22-27)26-11-9-24(10-12-26)20-29(34(39)40)37-33(38)31-18-17-30(42-31)23(2)3/h9-18,21-23,29H,4-8,19-20H2,1-3H3,(H,37,38)(H,39,40) |
| InChIKey | JSFJJPIAEABRLE-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.77 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|