C33H39N5O4 — CID 123159461
3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-2-[(1-propan-2-ylpyrazole-3-carbonyl)amino]propanoic acid (PubChem CID 123159461) has the molecular formula C33H39N5O4 and a molecular weight of 569.71 g/mol. Its IUPAC name is 3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-2-[(1-propan-2-ylpyrazole-3-carbonyl)amino]propanoic acid.
| Compound Name | 3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-2-[(1-propan-2-ylpyrazole-3-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 123159461 |
| Molecular Formula | C33H39N5O4 |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | 3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-2-[(1-propan-2-ylpyrazole-3-carbonyl)amino]propanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(NC(=O)c4ccn(C(C)C)n4)C(=O)O)cc3)nc2)cc1 |
| InChI | InChI=1S/C33H39N5O4/c1-4-5-6-7-8-19-42-28-15-13-25(14-16-28)27-21-34-31(35-22-27)26-11-9-24(10-12-26)20-30(33(40)41)36-32(39)29-17-18-38(37-29)23(2)3/h9-18,21-23,30H,4-8,19-20H2,1-3H3,(H,36,39)(H,40,41) |
| InChIKey | LCKGELYLGGOXSW-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|