C34H34N4O3S — CID 155130854
2-[(3-cyanobenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanethioic S-acid (PubChem CID 155130854) has the molecular formula C34H34N4O3S and a molecular weight of 578.74 g/mol. Its IUPAC name is 2-[(3-cyanobenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanethioic S-acid.
| Compound Name | 2-[(3-cyanobenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanethioic S-acid |
|---|---|
| PubChem CID | 155130854 |
| Molecular Formula | C34H34N4O3S |
| Molecular Weight | 578.74 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | 2-[(3-cyanobenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanethioic S-acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(NC(=O)c4cccc(C#N)c4)C(=O)S)cc3)nc2)cc1 |
| InChI | InChI=1S/C34H34N4O3S/c1-2-3-4-5-6-18-41-30-16-14-26(15-17-30)29-22-36-32(37-23-29)27-12-10-24(11-13-27)20-31(34(40)42)38-33(39)28-9-7-8-25(19-28)21-35/h7-17,19,22-23,31H,2-6,18,20H2,1H3,(H,38,39)(H,40,42) |
| InChIKey | WJGDFDRXNNDYGK-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.74 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|