C39H46N4O5 — CID 155084922
N-[(2S)-1-[3-(dihydroxymethyl)azetidin-1-yl]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxopropan-2-yl]-4-ethylbenzamide (PubChem CID 155084922) has the molecular formula C39H46N4O5 and a molecular weight of 650.82 g/mol. Its IUPAC name is N-[(2S)-1-[3-(dihydroxymethyl)azetidin-1-yl]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxopropan-2-yl]-4-ethylbenzamide.
| Compound Name | N-[(2S)-1-[3-(dihydroxymethyl)azetidin-1-yl]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxopropan-2-yl]-4-ethylbenzamide |
|---|---|
| PubChem CID | 155084922 |
| Molecular Formula | C39H46N4O5 |
| Molecular Weight | 650.82 g/mol |
| Exact Mass | 650.35 |
| IUPAC Name | N-[(2S)-1-[3-(dihydroxymethyl)azetidin-1-yl]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxopropan-2-yl]-4-ethylbenzamide |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(C[C@H](NC(=O)c4ccc(CC)cc4)C(=O)N4CC(C(O)O)C4)cc3)nc2)cc1 |
| InChI | InChI=1S/C39H46N4O5/c1-3-5-6-7-8-21-48-34-19-17-29(18-20-34)32-23-40-36(41-24-32)30-13-11-28(12-14-30)22-35(38(45)43-25-33(26-43)39(46)47)42-37(44)31-15-9-27(4-2)10-16-31/h9-20,23-24,33,35,39,46-47H,3-8,21-22,25-26H2,1-2H3,(H,42,44)/t35-/m0/s1 |
| InChIKey | BIBHOQQLYLBRNP-DHUJRADRSA-N |
| XLogP | 5.83 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.82 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|