C39H48N4O5 — CID 123469173
4-tert-butyl-N-[1-(2,2-dihydroxyethylamino)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxopropan-2-yl]benzamide (PubChem CID 123469173) has the molecular formula C39H48N4O5 and a molecular weight of 652.84 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-(2,2-dihydroxyethylamino)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxopropan-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[1-(2,2-dihydroxyethylamino)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 123469173 |
| Molecular Formula | C39H48N4O5 |
| Molecular Weight | 652.84 g/mol |
| Exact Mass | 652.36 |
| IUPAC Name | 4-tert-butyl-N-[1-(2,2-dihydroxyethylamino)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxopropan-2-yl]benzamide |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(NC(=O)c4ccc(C(C)(C)C)cc4)C(=O)NCC(O)O)cc3)nc2)cc1 |
| InChI | InChI=1S/C39H48N4O5/c1-5-6-7-8-9-22-48-33-20-16-28(17-21-33)31-24-40-36(41-25-31)29-12-10-27(11-13-29)23-34(38(47)42-26-35(44)45)43-37(46)30-14-18-32(19-15-30)39(2,3)4/h10-21,24-25,34-35,44-45H,5-9,22-23,26H2,1-4H3,(H,42,47)(H,43,46) |
| InChIKey | ZDERPDRKIUROFA-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 133.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.84 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|