C45H60N4O5 — CID 145099109
tert-butyl 2-[[2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]acetate;ethane (PubChem CID 145099109) has the molecular formula C45H60N4O5 and a molecular weight of 737.00 g/mol. Its IUPAC name is tert-butyl 2-[[2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]acetate;ethane.
| Compound Name | tert-butyl 2-[[2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]acetate;ethane |
|---|---|
| PubChem CID | 145099109 |
| Molecular Formula | C45H60N4O5 |
| Molecular Weight | 737.00 g/mol |
| Exact Mass | 736.46 |
| IUPAC Name | tert-butyl 2-[[2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]acetate;ethane |
| SMILES | CC.CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(NC(=O)c4ccc(C(C)(C)C)cc4)C(=O)NCC(=O)OC(C)(C)C)cc3)nc2)cc1 |
| InChI | InChI=1S/C43H54N4O5.C2H6/c1-8-9-10-11-12-25-51-36-23-19-31(20-24-36)34-27-44-39(45-28-34)32-15-13-30(14-16-32)26-37(41(50)46-29-38(48)52-43(5,6)7)47-40(49)33-17-21-35(22-18-33)42(2,3)4;1-2/h13-24,27-28,37H,8-12,25-26,29H2,1-7H3,(H,46,50)(H,47,49);1-2H3 |
| InChIKey | IHDDPTHGQBIWOI-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.00 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|