C46H62N4O5 — CID 145098999
tert-butyl 3-[[2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-[4-(5-methylhexoxy)phenyl]pyrimidin-2-yl]phenyl]propanoyl]amino]propanoate;ethane (PubChem CID 145098999) has the molecular formula C46H62N4O5 and a molecular weight of 751.03 g/mol. Its IUPAC name is tert-butyl 3-[[2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-[4-(5-methylhexoxy)phenyl]pyrimidin-2-yl]phenyl]propanoyl]amino]propanoate;ethane.
| Compound Name | tert-butyl 3-[[2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-[4-(5-methylhexoxy)phenyl]pyrimidin-2-yl]phenyl]propanoyl]amino]propanoate;ethane |
|---|---|
| PubChem CID | 145098999 |
| Molecular Formula | C46H62N4O5 |
| Molecular Weight | 751.03 g/mol |
| Exact Mass | 750.47 |
| IUPAC Name | tert-butyl 3-[[2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-[4-(5-methylhexoxy)phenyl]pyrimidin-2-yl]phenyl]propanoyl]amino]propanoate;ethane |
| SMILES | CC.CC(C)CCCCOc1ccc(-c2cnc(-c3ccc(CC(NC(=O)c4ccc(C(C)(C)C)cc4)C(=O)NCCC(=O)OC(C)(C)C)cc3)nc2)cc1 |
| InChI | InChI=1S/C44H56N4O5.C2H6/c1-30(2)11-9-10-26-52-37-22-18-32(19-23-37)35-28-46-40(47-29-35)33-14-12-31(13-15-33)27-38(42(51)45-25-24-39(49)53-44(6,7)8)48-41(50)34-16-20-36(21-17-34)43(3,4)5;1-2/h12-23,28-30,38H,9-11,24-27H2,1-8H3,(H,45,51)(H,48,50);1-2H3 |
| InChIKey | AQGJFFRHPWQVGW-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.03 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|